About 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one
1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one (PubChem CID 144910534) has the molecular formula C15H28O
and a molecular weight of 224.39 g/mol. Its IUPAC name is 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one.
Molecular Properties
| Compound Name | 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one |
| PubChem CID | 144910534 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one |
| SMILES | C=C(C)C(C)=O.CCCC1(CC)CCCC1 |
| InChI | InChI=1S/C10H20.C5H8O/c1-3-7-10(4-2)8-5-6-9-10;1-4(2)5(3)6/h3-9H2,1-2H3;1H2,2-3H3 |
| InChIKey | NOWZGEBRODGTAU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one?
The IUPAC name of 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one (CID 144910534) is 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one.
What is the SMILES notation for 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one?
The canonical SMILES for 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one is C=C(C)C(C)=O.CCCC1(CC)CCCC1.
What is the InChIKey of 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one?
The InChIKey is NOWZGEBRODGTAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.C5H8O/c1-3-7-10(4-2)8-5-6-9-10;1-4(2)5(3)6/h3-9H2,1-2H3;1H2,2-3H3.
What are the key properties of 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one?
1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one has a molecular weight of 224.39 g/mol, XLogP of 4.91, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-propylcyclopentane;3-methylbut-3-en-2-one is sourced from PubChem (CID 144910534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).