About ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane
ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane (PubChem CID 144911249) has the molecular formula C18H40N2O
and a molecular weight of 300.53 g/mol. Its IUPAC name is ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane.
Molecular Properties
| Compound Name | ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane |
| PubChem CID | 144911249 |
| Molecular Formula | C18H40N2O |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.31 |
| IUPAC Name | ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane |
| SMILES | CC.CCCCC.CN1CCC(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C11H22N2O.C5H12.C2H6/c1-12-4-2-11(3-5-12)10-13-6-8-14-9-7-13;1-3-5-4-2;1-2/h11H,2-10H2,1H3;3-5H2,1-2H3;1-2H3 |
| InChIKey | HCPWBALXPSCBEH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane?
The IUPAC name of ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane (CID 144911249) is ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane.
What is the SMILES notation for ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane?
The canonical SMILES for ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane is CC.CCCCC.CN1CCC(CN2CCOCC2)CC1.
What is the InChIKey of ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane?
The InChIKey is HCPWBALXPSCBEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O.C5H12.C2H6/c1-12-4-2-11(3-5-12)10-13-6-8-14-9-7-13;1-3-5-4-2;1-2/h11H,2-10H2,1H3;3-5H2,1-2H3;1-2H3.
What are the key properties of ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane?
ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane has a molecular weight of 300.53 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[(1-methylpiperidin-4-yl)methyl]morpholine;pentane is sourced from PubChem (CID 144911249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).