About 7,7-dimethyl-6,8-dihydrochromene-4,5-dione
7,7-dimethyl-6,8-dihydrochromene-4,5-dione (PubChem CID 14491206) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is 7,7-dimethyl-6,8-dihydrochromene-4,5-dione.
Molecular Properties
| Compound Name | 7,7-dimethyl-6,8-dihydrochromene-4,5-dione |
| PubChem CID | 14491206 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 7,7-dimethyl-6,8-dihydrochromene-4,5-dione |
| SMILES | CC1(C)CC(=O)c2c(occc2=O)C1 |
| InChI | InChI=1S/C11H12O3/c1-11(2)5-8(13)10-7(12)3-4-14-9(10)6-11/h3-4H,5-6H2,1-2H3 |
| InChIKey | IUWSSKPMUSTYHZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,7-dimethyl-6,8-dihydrochromene-4,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-6,8-dihydrochromene-4,5-dione?
The IUPAC name of 7,7-dimethyl-6,8-dihydrochromene-4,5-dione (CID 14491206) is 7,7-dimethyl-6,8-dihydrochromene-4,5-dione.
What is the SMILES notation for 7,7-dimethyl-6,8-dihydrochromene-4,5-dione?
The canonical SMILES for 7,7-dimethyl-6,8-dihydrochromene-4,5-dione is CC1(C)CC(=O)c2c(occc2=O)C1.
What is the InChIKey of 7,7-dimethyl-6,8-dihydrochromene-4,5-dione?
The InChIKey is IUWSSKPMUSTYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-11(2)5-8(13)10-7(12)3-4-14-9(10)6-11/h3-4H,5-6H2,1-2H3.
What are the key properties of 7,7-dimethyl-6,8-dihydrochromene-4,5-dione?
7,7-dimethyl-6,8-dihydrochromene-4,5-dione has a molecular weight of 192.21 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-6,8-dihydrochromene-4,5-dione is sourced from PubChem (CID 14491206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).