C14H16N6O2 — CID 144912183
5-[[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]amino]-1-(2-oxoethyl)indazole-3-carboxamide (PubChem CID 144912183) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 5-[[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]amino]-1-(2-oxoethyl)indazole-3-carboxamide.
| Compound Name | 5-[[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]amino]-1-(2-oxoethyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 144912183 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-[[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]amino]-1-(2-oxoethyl)indazole-3-carboxamide |
| SMILES | N/C=C\C=C(/N)Nc1ccc2c(c1)c(C(N)=O)nn2CC=O |
| InChI | InChI=1S/C14H16N6O2/c15-5-1-2-12(16)18-9-3-4-11-10(8-9)13(14(17)22)19-20(11)6-7-21/h1-5,7-8,18H,6,15-16H2,(H2,17,22)/b5-1-,12-2+ |
| InChIKey | ZJHJMADQFDANKD-MCCLWQHESA-N |
| XLogP | 0.02 |
| TPSA | 142.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|