C13H27N3O2 — CID 144912412
8-acetyl-2-methyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-a][1,2,4]triazin-1-one;ethane (PubChem CID 144912412) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 8-acetyl-2-methyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-a][1,2,4]triazin-1-one;ethane.
| Compound Name | 8-acetyl-2-methyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-a][1,2,4]triazin-1-one;ethane |
|---|---|
| PubChem CID | 144912412 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 8-acetyl-2-methyl-4,6,7,8-tetrahydro-3H-pyrazolo[1,2-a][1,2,4]triazin-1-one;ethane |
| SMILES | CC.CC.CC(=O)C1CCN2CCN(C)C(=O)N12 |
| InChI | InChI=1S/C9H15N3O2.2C2H6/c1-7(13)8-3-4-11-6-5-10(2)9(14)12(8)11;2*1-2/h8H,3-6H2,1-2H3;2*1-2H3 |
| InChIKey | OHLBZTFVZPZZTD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |