C32H39FN3O6P — CID 144912491
(2S,3aR,6aR)-1-[2-(3-acetyl-6-diethoxyphosphorylindol-1-yl)acetyl]-N-[(2-fluoro-3-methylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide (PubChem CID 144912491) has the molecular formula C32H39FN3O6P and a molecular weight of 611.65 g/mol. Its IUPAC name is (2S,3aR,6aR)-1-[2-(3-acetyl-6-diethoxyphosphorylindol-1-yl)acetyl]-N-[(2-fluoro-3-methylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide.
| Compound Name | (2S,3aR,6aR)-1-[2-(3-acetyl-6-diethoxyphosphorylindol-1-yl)acetyl]-N-[(2-fluoro-3-methylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 144912491 |
| Molecular Formula | C32H39FN3O6P |
| Molecular Weight | 611.65 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | (2S,3aR,6aR)-1-[2-(3-acetyl-6-diethoxyphosphorylindol-1-yl)acetyl]-N-[(2-fluoro-3-methylphenyl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide |
| SMILES | CCOP(=O)(OCC)c1ccc2c(C(C)=O)cn(CC(=O)N3[C@@H]4CCC[C@@H]4C[C@H]3C(=O)NCc3cccc(C)c3F)c2c1 |
| InChI | InChI=1S/C32H39FN3O6P/c1-5-41-43(40,42-6-2)24-13-14-25-26(21(4)37)18-35(28(25)16-24)19-30(38)36-27-12-8-10-22(27)15-29(36)32(39)34-17-23-11-7-9-20(3)31(23)33/h7,9,11,13-14,16,18,22,27,29H,5-6,8,10,12,15,17,19H2,1-4H3,(H,34,39)/t22-,27-,29+/m1/s1 |
| InChIKey | YRPSALOWPYHLEP-XRHWURSXSA-N |
| XLogP | 5.27 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|