C28H32ClF4N3O6S — CID 144912495
[3-acetyl-1-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]indol-6-yl] trifluoromethanesulfonate;1-(3-chloro-2-fluorophenyl)-N-methylmethanamine;ethane (PubChem CID 144912495) has the molecular formula C28H32ClF4N3O6S and a molecular weight of 650.09 g/mol. Its IUPAC name is [3-acetyl-1-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]indol-6-yl] trifluoromethanesulfonate;1-(3-chloro-2-fluorophenyl)-N-methylmethanamine;ethane.
| Compound Name | [3-acetyl-1-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]indol-6-yl] trifluoromethanesulfonate;1-(3-chloro-2-fluorophenyl)-N-methylmethanamine;ethane |
|---|---|
| PubChem CID | 144912495 |
| Molecular Formula | C28H32ClF4N3O6S |
| Molecular Weight | 650.09 g/mol |
| Exact Mass | 649.16 |
| IUPAC Name | [3-acetyl-1-[2-[(2S)-2-formylpyrrolidin-1-yl]-2-oxoethyl]indol-6-yl] trifluoromethanesulfonate;1-(3-chloro-2-fluorophenyl)-N-methylmethanamine;ethane |
| SMILES | CC.CC(=O)c1cn(CC(=O)N2CCC[C@H]2C=O)c2cc(OS(=O)(=O)C(F)(F)F)ccc12.CNCc1cccc(Cl)c1F |
| InChI | InChI=1S/C18H17F3N2O6S.C8H9ClFN.C2H6/c1-11(25)15-8-22(9-17(26)23-6-2-3-12(23)10-24)16-7-13(4-5-14(15)16)29-30(27,28)18(19,20)21;1-11-5-6-3-2-4-7(9)8(6)10;1-2/h4-5,7-8,10,12H,2-3,6,9H2,1H3;2-4,11H,5H2,1H3;1-2H3/t12-;;/m0../s1 |
| InChIKey | TVCZTRBYEIAING-LTCKWSDVSA-N |
| XLogP | 5.49 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.09 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|