C12H11BrFNO3 — CID 144912500
2-[6-bromo-5-fluoro-3-(1-hydroxyethyl)indol-1-yl]acetic acid (PubChem CID 144912500) has the molecular formula C12H11BrFNO3 and a molecular weight of 316.13 g/mol. Its IUPAC name is 2-[6-bromo-5-fluoro-3-(1-hydroxyethyl)indol-1-yl]acetic acid.
| Compound Name | 2-[6-bromo-5-fluoro-3-(1-hydroxyethyl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 144912500 |
| Molecular Formula | C12H11BrFNO3 |
| Molecular Weight | 316.13 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 2-[6-bromo-5-fluoro-3-(1-hydroxyethyl)indol-1-yl]acetic acid |
| SMILES | CC(O)c1cn(CC(=O)O)c2cc(Br)c(F)cc12 |
| InChI | InChI=1S/C12H11BrFNO3/c1-6(16)8-4-15(5-12(17)18)11-3-9(13)10(14)2-7(8)11/h2-4,6,16H,5H2,1H3,(H,17,18) |
| InChIKey | LEJMMJPOMUJQLF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |