C12H16F3NO2 — CID 144912703
ethane;1-[3-hydroxy-5-(trifluoromethyl)phenyl]azetidin-3-ol (PubChem CID 144912703) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is ethane;1-[3-hydroxy-5-(trifluoromethyl)phenyl]azetidin-3-ol.
| Compound Name | ethane;1-[3-hydroxy-5-(trifluoromethyl)phenyl]azetidin-3-ol |
|---|---|
| PubChem CID | 144912703 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | ethane;1-[3-hydroxy-5-(trifluoromethyl)phenyl]azetidin-3-ol |
| SMILES | CC.Oc1cc(N2CC(O)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F3NO2.C2H6/c11-10(12,13)6-1-7(3-8(15)2-6)14-4-9(16)5-14;1-2/h1-3,9,15-16H,4-5H2;1-2H3 |
| InChIKey | FFBJPJYTSPJMHD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |