C10H22O — CID 144913031
propane;trans-(1S,3S)-1-methoxy-3-methylcyclopentane (PubChem CID 144913031) has the molecular formula C10H22O and a molecular weight of 158.28 g/mol. Its IUPAC name is propane;trans-(1S,3S)-1-methoxy-3-methylcyclopentane.
| Compound Name | propane;trans-(1S,3S)-1-methoxy-3-methylcyclopentane |
|---|---|
| PubChem CID | 144913031 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | propane;trans-(1S,3S)-1-methoxy-3-methylcyclopentane |
| SMILES | CCC.CO[C@H]1CC[C@H](C)C1 |
| InChI | InChI=1S/C7H14O.C3H8/c1-6-3-4-7(5-6)8-2;1-3-2/h6-7H,3-5H2,1-2H3;3H2,1-2H3/t6-,7-;/m0./s1 |
| InChIKey | SGEMIWHIIPDMKM-LEUCUCNGSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |