C16H33NO — CID 144913058
(2S)-2-[(2R,6aS)-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]-N-methylpropanamide;molecular hydrogen;propane (PubChem CID 144913058) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is (2S)-2-[(2R,6aS)-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]-N-methylpropanamide;molecular hydrogen;propane.
| Compound Name | (2S)-2-[(2R,6aS)-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]-N-methylpropanamide;molecular hydrogen;propane |
|---|---|
| PubChem CID | 144913058 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | (2S)-2-[(2R,6aS)-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]-N-methylpropanamide;molecular hydrogen;propane |
| SMILES | CCC.CNC(=O)[C@@H](C)[C@@H]1CC2CCC[C@@]2(C)C1.[H][H] |
| InChI | InChI=1S/C13H23NO.C3H8.H2/c1-9(12(15)14-3)10-7-11-5-4-6-13(11,2)8-10;1-3-2;/h9-11H,4-8H2,1-3H3,(H,14,15);3H2,1-2H3;1H/t9-,10+,11?,13-;;/m0../s1 |
| InChIKey | LLSJSKBPAQRSMI-KRQUCWLHSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |