About bicyclo[2.2.1]heptane;ethane;methoxymethane
bicyclo[2.2.1]heptane;ethane;methoxymethane (PubChem CID 144913122) has the molecular formula C13H30O
and a molecular weight of 202.38 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane;ethane;methoxymethane.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane;ethane;methoxymethane |
| PubChem CID | 144913122 |
| Molecular Formula | C13H30O |
| Molecular Weight | 202.38 g/mol |
| Exact Mass | 202.23 |
| IUPAC Name | bicyclo[2.2.1]heptane;ethane;methoxymethane |
| SMILES | C1CC2CCC1C2.CC.CC.COC |
| InChI | InChI=1S/C7H12.C2H6O.2C2H6/c1-2-7-4-3-6(1)5-7;1-3-2;2*1-2/h6-7H,1-5H2;1-2H3;2*1-2H3 |
| InChIKey | UXBPHFJJKIQNIQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[2.2.1]heptane;ethane;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane;ethane;methoxymethane?
The IUPAC name of bicyclo[2.2.1]heptane;ethane;methoxymethane (CID 144913122) is bicyclo[2.2.1]heptane;ethane;methoxymethane.
What is the SMILES notation for bicyclo[2.2.1]heptane;ethane;methoxymethane?
The canonical SMILES for bicyclo[2.2.1]heptane;ethane;methoxymethane is C1CC2CCC1C2.CC.CC.COC.
What is the InChIKey of bicyclo[2.2.1]heptane;ethane;methoxymethane?
The InChIKey is UXBPHFJJKIQNIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.C2H6O.2C2H6/c1-2-7-4-3-6(1)5-7;1-3-2;2*1-2/h6-7H,1-5H2;1-2H3;2*1-2H3.
What are the key properties of bicyclo[2.2.1]heptane;ethane;methoxymethane?
bicyclo[2.2.1]heptane;ethane;methoxymethane has a molecular weight of 202.38 g/mol, XLogP of 4.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane;ethane;methoxymethane is sourced from PubChem (CID 144913122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).