C28H29F2N5O3 — CID 144913168
2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[(1E,3Z)-1-(ethylamino)penta-1,3-dien-2-yl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 144913168) has the molecular formula C28H29F2N5O3 and a molecular weight of 521.57 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[(1E,3Z)-1-(ethylamino)penta-1,3-dien-2-yl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[(1E,3Z)-1-(ethylamino)penta-1,3-dien-2-yl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 144913168 |
| Molecular Formula | C28H29F2N5O3 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-[[(1E,3Z)-1-(ethylamino)penta-1,3-dien-2-yl]amino]-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | C/C=C\C(=C/NCC)Nc1nc(-c2c(F)cccc2F)nc2c1C(=O)N(Cc1ccc(OC)cc1OC)C2 |
| InChI | InChI=1S/C28H29F2N5O3/c1-5-8-18(14-31-6-2)32-27-25-22(33-26(34-27)24-20(29)9-7-10-21(24)30)16-35(28(25)36)15-17-11-12-19(37-3)13-23(17)38-4/h5,7-14,31H,6,15-16H2,1-4H3,(H,32,33,34)/b8-5-,18-14+ |
| InChIKey | WHDUCZIFUAUOAH-PYMLHBSYSA-N |
| XLogP | 5.03 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|