C22H20F2N4O4 — CID 144913241
2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-(methoxyamino)-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 144913241) has the molecular formula C22H20F2N4O4 and a molecular weight of 442.42 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-(methoxyamino)-7H-pyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-(methoxyamino)-7H-pyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 144913241 |
| Molecular Formula | C22H20F2N4O4 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-(2,6-difluorophenyl)-6-[(2,4-dimethoxyphenyl)methyl]-4-(methoxyamino)-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | CONc1nc(-c2c(F)cccc2F)nc2c1C(=O)N(Cc1ccc(OC)cc1OC)C2 |
| InChI | InChI=1S/C22H20F2N4O4/c1-30-13-8-7-12(17(9-13)31-2)10-28-11-16-19(22(28)29)21(27-32-3)26-20(25-16)18-14(23)5-4-6-15(18)24/h4-9H,10-11H2,1-3H3,(H,25,26,27) |
| InChIKey | XOFSMJPCAIENHV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|