C23H20F2N4O2 — CID 144913269
N-[3-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-4-yl]amino]phenyl]propyl]formamide (PubChem CID 144913269) has the molecular formula C23H20F2N4O2 and a molecular weight of 422.44 g/mol. Its IUPAC name is N-[3-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-4-yl]amino]phenyl]propyl]formamide.
| Compound Name | N-[3-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-4-yl]amino]phenyl]propyl]formamide |
|---|---|
| PubChem CID | 144913269 |
| Molecular Formula | C23H20F2N4O2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[3-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-4-yl]amino]phenyl]propyl]formamide |
| SMILES | O=CNCCCc1ccc(Nc2cc(-c3c(F)cccc3F)nc3c2C(=O)NC3)cc1 |
| InChI | InChI=1S/C23H20F2N4O2/c24-16-4-1-5-17(25)21(16)18-11-19(22-20(29-18)12-27-23(22)31)28-15-8-6-14(7-9-15)3-2-10-26-13-30/h1,4-9,11,13H,2-3,10,12H2,(H,26,30)(H,27,31)(H,28,29) |
| InChIKey | UBGADHMBKNEXND-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|