About 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea
1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea (PubChem CID 144914028) has the molecular formula C11H25N3O2
and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea |
| PubChem CID | 144914028 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea |
| SMILES | CN[C@H](CO)CN(C)C(=O)N(C)C(C)(C)C |
| InChI | InChI=1S/C11H25N3O2/c1-11(2,3)14(6)10(16)13(5)7-9(8-15)12-4/h9,12,15H,7-8H2,1-6H3/t9-/m0/s1 |
| InChIKey | OKEZANAHZQJXDU-VIFPVBQESA-N |
| XLogP | 0.35 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea?
The IUPAC name of 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea (CID 144914028) is 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea.
What is the SMILES notation for 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea?
The canonical SMILES for 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea is CN[C@H](CO)CN(C)C(=O)N(C)C(C)(C)C.
What is the InChIKey of 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea?
The InChIKey is OKEZANAHZQJXDU-VIFPVBQESA-N. The full InChI is InChI=1S/C11H25N3O2/c1-11(2,3)14(6)10(16)13(5)7-9(8-15)12-4/h9,12,15H,7-8H2,1-6H3/t9-/m0/s1.
What are the key properties of 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea?
1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea has a molecular weight of 231.34 g/mol, XLogP of 0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-[(2S)-3-hydroxy-2-(methylamino)propyl]-1,3-dimethylurea is sourced from PubChem (CID 144914028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).