About 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine
5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine (PubChem CID 144914180) has the molecular formula C11H12BrN
and a molecular weight of 238.13 g/mol. Its IUPAC name is 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine.
Molecular Properties
| Compound Name | 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine |
| PubChem CID | 144914180 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine |
| SMILES | C=CC/C=C/c1cc(Br)cnc1C |
| InChI | InChI=1S/C11H12BrN/c1-3-4-5-6-10-7-11(12)8-13-9(10)2/h3,5-8H,1,4H2,2H3/b6-5+ |
| InChIKey | PUILHSRRVFRZKT-AATRIKPKSA-N |
| XLogP | 3.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine?
The IUPAC name of 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine (CID 144914180) is 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine.
What is the SMILES notation for 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine?
The canonical SMILES for 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine is C=CC/C=C/c1cc(Br)cnc1C.
What is the InChIKey of 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine?
The InChIKey is PUILHSRRVFRZKT-AATRIKPKSA-N. The full InChI is InChI=1S/C11H12BrN/c1-3-4-5-6-10-7-11(12)8-13-9(10)2/h3,5-8H,1,4H2,2H3/b6-5+.
What are the key properties of 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine?
5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine has a molecular weight of 238.13 g/mol, XLogP of 3.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methyl-3-[(1E)-penta-1,4-dienyl]pyridine is sourced from PubChem (CID 144914180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).