C13H13BI2O — CID 144914251
[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-diiodoborane (PubChem CID 144914251) has the molecular formula C13H13BI2O and a molecular weight of 449.87 g/mol. Its IUPAC name is [4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-diiodoborane.
| Compound Name | [4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-diiodoborane |
|---|---|
| PubChem CID | 144914251 |
| Molecular Formula | C13H13BI2O |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.91 |
| IUPAC Name | [4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-diiodoborane |
| SMILES | C=C/C(=C\C=C/C)Oc1ccc(B(I)I)cc1 |
| InChI | InChI=1S/C13H13BI2O/c1-3-5-6-12(4-2)17-13-9-7-11(8-10-13)14(15)16/h3-10H,2H2,1H3/b5-3-,12-6+ |
| InChIKey | HOTZXQZIRSCCPW-YXMBOXQASA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|