C41H32N2 — CID 144914740
10,10-dimethyl-18-(9-phenylcarbazol-3-yl)-22-azapentacyclo[11.9.0.03,11.04,9.016,21]docosa-1,3(11),4,6,8,12,14,16(21),17,19-decaene;molecular hydrogen (PubChem CID 144914740) has the molecular formula C41H32N2 and a molecular weight of 552.72 g/mol. Its IUPAC name is 10,10-dimethyl-18-(9-phenylcarbazol-3-yl)-22-azapentacyclo[11.9.0.03,11.04,9.016,21]docosa-1,3(11),4,6,8,12,14,16(21),17,19-decaene;molecular hydrogen.
| Compound Name | 10,10-dimethyl-18-(9-phenylcarbazol-3-yl)-22-azapentacyclo[11.9.0.03,11.04,9.016,21]docosa-1,3(11),4,6,8,12,14,16(21),17,19-decaene;molecular hydrogen |
|---|---|
| PubChem CID | 144914740 |
| Molecular Formula | C41H32N2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 10,10-dimethyl-18-(9-phenylcarbazol-3-yl)-22-azapentacyclo[11.9.0.03,11.04,9.016,21]docosa-1,3(11),4,6,8,12,14,16(21),17,19-decaene;molecular hydrogen |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)C=Cc1cc(-c2ccc4c(c2)c2ccccc2n4-c2ccccc2)ccc1N3.[H][H] |
| InChI | InChI=1S/C41H30N2.H2/c1-41(2)35-14-8-6-12-31(35)33-25-38-29(24-36(33)41)17-16-28-22-26(18-20-37(28)42-38)27-19-21-40-34(23-27)32-13-7-9-15-39(32)43(40)30-10-4-3-5-11-30;/h3-25,42H,1-2H3;1H |
| InChIKey | ZZQMDEUWJGSFOR-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|