C17H17N3 — CID 144914945
2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-(4-methylphenyl)-1,3,5-triazine (PubChem CID 144914945) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-(4-methylphenyl)-1,3,5-triazine.
| Compound Name | 2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-(4-methylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 144914945 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-(4-methylphenyl)-1,3,5-triazine |
| SMILES | C=C/C=C\C(=C/C)c1ncnc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C17H17N3/c1-4-6-7-14(5-2)16-18-12-19-17(20-16)15-10-8-13(3)9-11-15/h4-12H,1H2,2-3H3/b7-6-,14-5+ |
| InChIKey | BVJVDPLXXFEYMO-WFRORPSUSA-N |
| XLogP | 3.99 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|