C26H16FeN4O4 — CID 14491537
iron;bis(1,10-phenanthroline-2-carboxylic acid) (PubChem CID 14491537) has the molecular formula C26H16FeN4O4 and a molecular weight of 504.28 g/mol. Its IUPAC name is iron;bis(1,10-phenanthroline-2-carboxylic acid).
| Compound Name | iron;bis(1,10-phenanthroline-2-carboxylic acid) |
|---|---|
| PubChem CID | 14491537 |
| Molecular Formula | C26H16FeN4O4 |
| Molecular Weight | 504.28 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | iron;bis(1,10-phenanthroline-2-carboxylic acid) |
| SMILES | O=C(O)c1ccc2ccc3cccnc3c2n1.O=C(O)c1ccc2ccc3cccnc3c2n1.[Fe] |
| InChI | InChI=1S/2C13H8N2O2.Fe/c2*16-13(17)10-6-5-9-4-3-8-2-1-7-14-11(8)12(9)15-10;/h2*1-7H,(H,16,17); |
| InChIKey | RAZNMZHLZZMJJV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.28 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|