C13H19ClO2 — CID 144916054
ethane;methyl 2-(2-chloro-3,4-dimethylphenyl)acetate (PubChem CID 144916054) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is ethane;methyl 2-(2-chloro-3,4-dimethylphenyl)acetate.
| Compound Name | ethane;methyl 2-(2-chloro-3,4-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 144916054 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | ethane;methyl 2-(2-chloro-3,4-dimethylphenyl)acetate |
| SMILES | CC.COC(=O)Cc1ccc(C)c(C)c1Cl |
| InChI | InChI=1S/C11H13ClO2.C2H6/c1-7-4-5-9(6-10(13)14-3)11(12)8(7)2;1-2/h4-5H,6H2,1-3H3;1-2H3 |
| InChIKey | RDFORKUJEFRJRJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |