C18H20INO4S — CID 144916122
(6-methyl-2,3-dihydroindol-1-yl) thiohypoiodite;8-methylidene-6,10-dioxaspiro[4.5]decane-7,9-dione (PubChem CID 144916122) has the molecular formula C18H20INO4S and a molecular weight of 473.33 g/mol. Its IUPAC name is (6-methyl-2,3-dihydroindol-1-yl) thiohypoiodite;8-methylidene-6,10-dioxaspiro[4.5]decane-7,9-dione.
| Compound Name | (6-methyl-2,3-dihydroindol-1-yl) thiohypoiodite;8-methylidene-6,10-dioxaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 144916122 |
| Molecular Formula | C18H20INO4S |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | (6-methyl-2,3-dihydroindol-1-yl) thiohypoiodite;8-methylidene-6,10-dioxaspiro[4.5]decane-7,9-dione |
| SMILES | C=C1C(=O)OC2(CCCC2)OC1=O.Cc1ccc2c(c1)N(SI)CC2 |
| InChI | InChI=1S/C9H10INS.C9H10O4/c1-7-2-3-8-4-5-11(12-10)9(8)6-7;1-6-7(10)12-9(13-8(6)11)4-2-3-5-9/h2-3,6H,4-5H2,1H3;1-5H2 |
| InChIKey | LJJVJVOSJZTDDX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|