About benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one
benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 144917328) has the molecular formula C20H27NO4
and a molecular weight of 345.44 g/mol. Its IUPAC name is benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
| PubChem CID | 144917328 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CCOC1CCC(/C=C/C(=O)N2CCOC2=O)CC1.c1ccccc1 |
| InChI | InChI=1S/C14H21NO4.C6H6/c1-2-18-12-6-3-11(4-7-12)5-8-13(16)15-9-10-19-14(15)17;1-2-4-6-5-3-1/h5,8,11-12H,2-4,6-7,9-10H2,1H3;1-6H/b8-5+; |
| InChIKey | OFPCQKRQLGBHPU-HAAWTFQLSA-N |
| XLogP | 3.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one?
The IUPAC name of benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one (CID 144917328) is benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one?
The canonical SMILES for benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one is CCOC1CCC(/C=C/C(=O)N2CCOC2=O)CC1.c1ccccc1.
What is the InChIKey of benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one?
The InChIKey is OFPCQKRQLGBHPU-HAAWTFQLSA-N. The full InChI is InChI=1S/C14H21NO4.C6H6/c1-2-18-12-6-3-11(4-7-12)5-8-13(16)15-9-10-19-14(15)17;1-2-4-6-5-3-1/h5,8,11-12H,2-4,6-7,9-10H2,1H3;1-6H/b8-5+;.
What are the key properties of benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one?
benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one has a molecular weight of 345.44 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;3-[(E)-3-(4-ethoxycyclohexyl)prop-2-enoyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 144917328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).