C32H52O5 — CID 144917756
5b,8,11a-trimethyl-1,2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysene-3a-carboxylic acid;oxiran-2-ylmethyl butanoate (PubChem CID 144917756) has the molecular formula C32H52O5 and a molecular weight of 516.76 g/mol. Its IUPAC name is 5b,8,11a-trimethyl-1,2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysene-3a-carboxylic acid;oxiran-2-ylmethyl butanoate.
| Compound Name | 5b,8,11a-trimethyl-1,2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysene-3a-carboxylic acid;oxiran-2-ylmethyl butanoate |
|---|---|
| PubChem CID | 144917756 |
| Molecular Formula | C32H52O5 |
| Molecular Weight | 516.76 g/mol |
| Exact Mass | 516.38 |
| IUPAC Name | 5b,8,11a-trimethyl-1,2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13a,13b-octadecahydrocyclopenta[a]chrysene-3a-carboxylic acid;oxiran-2-ylmethyl butanoate |
| SMILES | CC1CCCC2(C)C1CCC1(C)C3CCC4(C(=O)O)CCCC4C3CCC21.CCCC(=O)OCC1CO1 |
| InChI | InChI=1S/C25H40O2.C7H12O3/c1-16-6-4-12-23(2)18(16)10-14-24(3)19-11-15-25(22(26)27)13-5-7-20(25)17(19)8-9-21(23)24;1-2-3-7(8)10-5-6-4-9-6/h16-21H,4-15H2,1-3H3,(H,26,27);6H,2-5H2,1H3 |
| InChIKey | IQSZDDKFMILWQX-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.76 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|