About (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate
(5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate (PubChem CID 14491778) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate |
| PubChem CID | 14491778 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate |
| SMILES | C=C=CC(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C14H22O2/c1-5-6-14(15)16-13-9-11(4)7-8-12(13)10(2)3/h6,10-13H,1,7-9H2,2-4H3 |
| InChIKey | XFIKRCYOIWXLIT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate (CID 14491778) is (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate is C=C=CC(=O)OC1CC(C)CCC1C(C)C.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate?
The InChIKey is XFIKRCYOIWXLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-5-6-14(15)16-13-9-11(4)7-8-12(13)10(2)3/h6,10-13H,1,7-9H2,2-4H3.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate?
(5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate has a molecular weight of 222.33 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) buta-2,3-dienoate is sourced from PubChem (CID 14491778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).