About ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine
ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine (PubChem CID 144918286) has the molecular formula C22H50N2O
and a molecular weight of 358.66 g/mol. Its IUPAC name is ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine.
Molecular Properties
| Compound Name | ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine |
| PubChem CID | 144918286 |
| Molecular Formula | C22H50N2O |
| Molecular Weight | 358.66 g/mol |
| Exact Mass | 358.39 |
| IUPAC Name | ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine |
| SMILES | C=C(C)NCCCC(C)(CC)OCCC(C)(CC)CNC.CC.CC |
| InChI | InChI=1S/C18H38N2O.2C2H6/c1-8-17(5,15-19-7)12-14-21-18(6,9-2)11-10-13-20-16(3)4;2*1-2/h19-20H,3,8-15H2,1-2,4-7H3;2*1-2H3 |
| InChIKey | LWJCLYLEQRCGIH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine?
The IUPAC name of ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine (CID 144918286) is ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine.
What is the SMILES notation for ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine?
The canonical SMILES for ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine is C=C(C)NCCCC(C)(CC)OCCC(C)(CC)CNC.CC.CC.
What is the InChIKey of ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine?
The InChIKey is LWJCLYLEQRCGIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38N2O.2C2H6/c1-8-17(5,15-19-7)12-14-21-18(6,9-2)11-10-13-20-16(3)4;2*1-2/h19-20H,3,8-15H2,1-2,4-7H3;2*1-2H3.
What are the key properties of ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine?
ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine has a molecular weight of 358.66 g/mol, XLogP of 6.15, 13 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-N,2-dimethyl-4-[3-methyl-6-(prop-1-en-2-ylamino)hexan-3-yl]oxybutan-1-amine is sourced from PubChem (CID 144918286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).