C43H38S2 — CID 144918406
[(2E,4Z)-hepta-2,4,6-trien-3-yl]-diphenyl-[4-(triphenyl-λ4-sulfanyl)phenyl]-λ4-sulfane (PubChem CID 144918406) has the molecular formula C43H38S2 and a molecular weight of 618.91 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4,6-trien-3-yl]-diphenyl-[4-(triphenyl-λ4-sulfanyl)phenyl]-λ4-sulfane.
| Compound Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]-diphenyl-[4-(triphenyl-λ4-sulfanyl)phenyl]-λ4-sulfane |
|---|---|
| PubChem CID | 144918406 |
| Molecular Formula | C43H38S2 |
| Molecular Weight | 618.91 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]-diphenyl-[4-(triphenyl-λ4-sulfanyl)phenyl]-λ4-sulfane |
| SMILES | C=C/C=C\C(=C/C)S(c1ccccc1)(c1ccccc1)c1ccc(S(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H38S2/c1-3-5-21-36(4-2)44(37-22-11-6-12-23-37,38-24-13-7-14-25-38)42-32-34-43(35-33-42)45(39-26-15-8-16-27-39,40-28-17-9-18-29-40)41-30-19-10-20-31-41/h3-35H,1H2,2H3/b21-5-,36-4+ |
| InChIKey | FGLBTBNZXZPQDV-XCDZETDVSA-N |
| XLogP | 12.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.91 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|