C15H32O2 — CID 144918412
(Z)-3,5-dimethoxy-2,2,6,6-tetramethylhept-3-ene;ethane (PubChem CID 144918412) has the molecular formula C15H32O2 and a molecular weight of 244.42 g/mol. Its IUPAC name is (Z)-3,5-dimethoxy-2,2,6,6-tetramethylhept-3-ene;ethane.
| Compound Name | (Z)-3,5-dimethoxy-2,2,6,6-tetramethylhept-3-ene;ethane |
|---|---|
| PubChem CID | 144918412 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | (Z)-3,5-dimethoxy-2,2,6,6-tetramethylhept-3-ene;ethane |
| SMILES | CC.CO/C(=C\C(OC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H26O2.C2H6/c1-12(2,3)10(14-7)9-11(15-8)13(4,5)6;1-2/h9-10H,1-8H3;1-2H3/b11-9-; |
| InChIKey | LKVHXJPHOHACBB-KSIDEHCFSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|