C32H36NOP — CID 144918672
6-cyclohexyl-N-[(3Z)-penta-1,3-dien-3-yl]-N-[4-(2-phosphanylpropan-2-yl)phenyl]dibenzofuran-4-amine (PubChem CID 144918672) has the molecular formula C32H36NOP and a molecular weight of 481.62 g/mol. Its IUPAC name is 6-cyclohexyl-N-[(3Z)-penta-1,3-dien-3-yl]-N-[4-(2-phosphanylpropan-2-yl)phenyl]dibenzofuran-4-amine.
| Compound Name | 6-cyclohexyl-N-[(3Z)-penta-1,3-dien-3-yl]-N-[4-(2-phosphanylpropan-2-yl)phenyl]dibenzofuran-4-amine |
|---|---|
| PubChem CID | 144918672 |
| Molecular Formula | C32H36NOP |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 6-cyclohexyl-N-[(3Z)-penta-1,3-dien-3-yl]-N-[4-(2-phosphanylpropan-2-yl)phenyl]dibenzofuran-4-amine |
| SMILES | C=C/C(=C/C)N(c1ccc(C(C)(C)P)cc1)c1cccc2c1oc1c(C3CCCCC3)cccc12 |
| InChI | InChI=1S/C32H36NOP/c1-5-24(6-2)33(25-20-18-23(19-21-25)32(3,4)35)29-17-11-16-28-27-15-10-14-26(30(27)34-31(28)29)22-12-8-7-9-13-22/h5-6,10-11,14-22H,1,7-9,12-13,35H2,2-4H3/b24-6- |
| InChIKey | HCAGXZGGTXGGJH-UMDHDWCXSA-N |
| XLogP | 9.97 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|