About 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene
2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene (PubChem CID 144918675) has the molecular formula C22H28O
and a molecular weight of 308.47 g/mol. Its IUPAC name is 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene |
| PubChem CID | 144918675 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene |
| SMILES | CC1=C(Oc2ccccc2C)C(C2CCCCCC2)=CCC=C1 |
| InChI | InChI=1S/C22H28O/c1-17-11-8-10-16-21(17)23-22-18(2)12-7-9-15-20(22)19-13-5-3-4-6-14-19/h7-8,10-12,15-16,19H,3-6,9,13-14H2,1-2H3 |
| InChIKey | STCBMGADGOCUCL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene?
The IUPAC name of 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene (CID 144918675) is 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene.
What is the SMILES notation for 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene?
The canonical SMILES for 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene is CC1=C(Oc2ccccc2C)C(C2CCCCCC2)=CCC=C1.
What is the InChIKey of 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene?
The InChIKey is STCBMGADGOCUCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O/c1-17-11-8-10-16-21(17)23-22-18(2)12-7-9-15-20(22)19-13-5-3-4-6-14-19/h7-8,10-12,15-16,19H,3-6,9,13-14H2,1-2H3.
What are the key properties of 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene?
2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene has a molecular weight of 308.47 g/mol, XLogP of 6.50, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyl-4-methyl-3-(2-methylphenoxy)cyclohepta-1,3,5-triene is sourced from PubChem (CID 144918675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).