C67H66N2O2 — CID 144918740
2-N,9-N-bis(6-tert-butyldibenzofuran-4-yl)-2-N,9-N-bis(4-methylphenyl)tetracyclo[10.3.2.05,15.08,13]heptadeca-1,3,5(15),6,8,10,12,16-octaene-2,9-diamine;ethane (PubChem CID 144918740) has the molecular formula C67H66N2O2 and a molecular weight of 931.28 g/mol. Its IUPAC name is 2-N,9-N-bis(6-tert-butyldibenzofuran-4-yl)-2-N,9-N-bis(4-methylphenyl)tetracyclo[10.3.2.05,15.08,13]heptadeca-1,3,5(15),6,8,10,12,16-octaene-2,9-diamine;ethane.
| Compound Name | 2-N,9-N-bis(6-tert-butyldibenzofuran-4-yl)-2-N,9-N-bis(4-methylphenyl)tetracyclo[10.3.2.05,15.08,13]heptadeca-1,3,5(15),6,8,10,12,16-octaene-2,9-diamine;ethane |
|---|---|
| PubChem CID | 144918740 |
| Molecular Formula | C67H66N2O2 |
| Molecular Weight | 931.28 g/mol |
| Exact Mass | 930.51 |
| IUPAC Name | 2-N,9-N-bis(6-tert-butyldibenzofuran-4-yl)-2-N,9-N-bis(4-methylphenyl)tetracyclo[10.3.2.05,15.08,13]heptadeca-1,3,5(15),6,8,10,12,16-octaene-2,9-diamine;ethane |
| SMILES | CC.CC.Cc1ccc(N(c2ccc3c4c2C=Cc2ccc(N(c5ccc(C)cc5)c5cccc6c5oc5c(C(C)(C)C)cccc56)c(c2C4)C=C3)c2cccc3c2oc2c(C(C)(C)C)cccc23)cc1 |
| InChI | InChI=1S/C63H54N2O2.2C2H6/c1-38-21-29-42(30-22-38)64(56-19-11-15-48-46-13-9-17-52(62(3,4)5)58(46)66-60(48)56)54-35-27-40-26-34-45-51-37-50(40)44(54)33-25-41(51)28-36-55(45)65(43-31-23-39(2)24-32-43)57-20-12-16-49-47-14-10-18-53(63(6,7)8)59(47)67-61(49)57;2*1-2/h9-36H,37H2,1-8H3;2*1-2H3 |
| InChIKey | QYZGKJSTSCIKCV-UHFFFAOYSA-N |
| XLogP | 20.25 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.28 |
| LogP ≤ 5 | 20.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|