About 1-bromo-2-methyloctane
1-bromo-2-methyloctane (PubChem CID 14491953) has the molecular formula C9H19Br
and a molecular weight of 207.15 g/mol. Its IUPAC name is 1-bromo-2-methyloctane.
Molecular Properties
| Compound Name | 1-bromo-2-methyloctane |
| PubChem CID | 14491953 |
| Molecular Formula | C9H19Br |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 1-bromo-2-methyloctane |
| SMILES | CCCCCCC(C)CBr |
| InChI | InChI=1S/C9H19Br/c1-3-4-5-6-7-9(2)8-10/h9H,3-8H2,1-2H3 |
| InChIKey | XHYRIXNUUUUPAL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-methyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methyloctane?
The IUPAC name of 1-bromo-2-methyloctane (CID 14491953) is 1-bromo-2-methyloctane.
What is the SMILES notation for 1-bromo-2-methyloctane?
The canonical SMILES for 1-bromo-2-methyloctane is CCCCCCC(C)CBr.
What is the InChIKey of 1-bromo-2-methyloctane?
The InChIKey is XHYRIXNUUUUPAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19Br/c1-3-4-5-6-7-9(2)8-10/h9H,3-8H2,1-2H3.
What are the key properties of 1-bromo-2-methyloctane?
1-bromo-2-methyloctane has a molecular weight of 207.15 g/mol, XLogP of 3.99, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methyloctane is sourced from PubChem (CID 14491953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).