About (2R,6S)-4-fluoro-2,6-dipropyloxane
(2R,6S)-4-fluoro-2,6-dipropyloxane (PubChem CID 14492058) has the molecular formula C11H21FO
and a molecular weight of 188.29 g/mol. Its IUPAC name is (2R,6S)-4-fluoro-2,6-dipropyloxane.
Molecular Properties
| Compound Name | (2R,6S)-4-fluoro-2,6-dipropyloxane |
| PubChem CID | 14492058 |
| Molecular Formula | C11H21FO |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (2R,6S)-4-fluoro-2,6-dipropyloxane |
| SMILES | CCC[C@@H]1CC(F)C[C@H](CCC)O1 |
| InChI | InChI=1S/C11H21FO/c1-3-5-10-7-9(12)8-11(13-10)6-4-2/h9-11H,3-8H2,1-2H3/t9?,10-,11+ |
| InChIKey | GNNIHZODKQNODE-FGWVZKOKSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,6S)-4-fluoro-2,6-dipropyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-4-fluoro-2,6-dipropyloxane?
The IUPAC name of (2R,6S)-4-fluoro-2,6-dipropyloxane (CID 14492058) is (2R,6S)-4-fluoro-2,6-dipropyloxane.
What is the SMILES notation for (2R,6S)-4-fluoro-2,6-dipropyloxane?
The canonical SMILES for (2R,6S)-4-fluoro-2,6-dipropyloxane is CCC[C@@H]1CC(F)C[C@H](CCC)O1.
What is the InChIKey of (2R,6S)-4-fluoro-2,6-dipropyloxane?
The InChIKey is GNNIHZODKQNODE-FGWVZKOKSA-N. The full InChI is InChI=1S/C11H21FO/c1-3-5-10-7-9(12)8-11(13-10)6-4-2/h9-11H,3-8H2,1-2H3/t9?,10-,11+.
What are the key properties of (2R,6S)-4-fluoro-2,6-dipropyloxane?
(2R,6S)-4-fluoro-2,6-dipropyloxane has a molecular weight of 188.29 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-4-fluoro-2,6-dipropyloxane is sourced from PubChem (CID 14492058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).