C14H22KNO3 — CID 144920830
potassium;3-carboxypropyl-[(2E,4E)-4-methylhexa-2,4-dienoyl]azanide;prop-1-ene (PubChem CID 144920830) has the molecular formula C14H22KNO3 and a molecular weight of 291.43 g/mol. Its IUPAC name is potassium;3-carboxypropyl-[(2E,4E)-4-methylhexa-2,4-dienoyl]azanide;prop-1-ene.
| Compound Name | potassium;3-carboxypropyl-[(2E,4E)-4-methylhexa-2,4-dienoyl]azanide;prop-1-ene |
|---|---|
| PubChem CID | 144920830 |
| Molecular Formula | C14H22KNO3 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | potassium;3-carboxypropyl-[(2E,4E)-4-methylhexa-2,4-dienoyl]azanide;prop-1-ene |
| SMILES | C/C=C(C)/C=C/C(=O)[N-]CCCC(=O)O.C=CC.[K+] |
| InChI | InChI=1S/C11H17NO3.C3H6.K/c1-3-9(2)6-7-10(13)12-8-4-5-11(14)15;1-3-2;/h3,6-7H,4-5,8H2,1-2H3,(H2,12,13,14,15);3H,1H2,2H3;/q;;+1/p-1/b7-6+,9-3+;; |
| InChIKey | FUFBIHKCHSFDFQ-RWNWNGJQSA-M |
| XLogP | 0.47 |
| TPSA | 68.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|