C20H32ClNO — CID 144921263
4-(4-chlorophenyl)-N-methyl-6-(oxan-2-yl)hex-1-en-2-amine;ethane (PubChem CID 144921263) has the molecular formula C20H32ClNO and a molecular weight of 337.94 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-methyl-6-(oxan-2-yl)hex-1-en-2-amine;ethane.
| Compound Name | 4-(4-chlorophenyl)-N-methyl-6-(oxan-2-yl)hex-1-en-2-amine;ethane |
|---|---|
| PubChem CID | 144921263 |
| Molecular Formula | C20H32ClNO |
| Molecular Weight | 337.94 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 4-(4-chlorophenyl)-N-methyl-6-(oxan-2-yl)hex-1-en-2-amine;ethane |
| SMILES | C=C(CC(CCC1CCCCO1)c1ccc(Cl)cc1)NC.CC |
| InChI | InChI=1S/C18H26ClNO.C2H6/c1-14(20-2)13-16(15-6-9-17(19)10-7-15)8-11-18-5-3-4-12-21-18;1-2/h6-7,9-10,16,18,20H,1,3-5,8,11-13H2,2H3;1-2H3 |
| InChIKey | BVWHVFXLDGECIX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.94 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |