About acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine
acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine (PubChem CID 144921282) has the molecular formula C17H17BrN4
and a molecular weight of 357.26 g/mol. Its IUPAC name is acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine.
Molecular Properties
| Compound Name | acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine |
| PubChem CID | 144921282 |
| Molecular Formula | C17H17BrN4 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine |
| SMILES | C#C.CCNc1cnc(C)c(-c2cc3c(Br)cccc3[nH]2)n1 |
| InChI | InChI=1S/C15H15BrN4.C2H2/c1-3-17-14-8-18-9(2)15(20-14)13-7-10-11(16)5-4-6-12(10)19-13;1-2/h4-8,19H,3H2,1-2H3,(H,17,20);1-2H |
| InChIKey | OQIWZXOGGLHLDQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine?
The IUPAC name of acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine (CID 144921282) is acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine.
What is the SMILES notation for acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine?
The canonical SMILES for acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine is C#C.CCNc1cnc(C)c(-c2cc3c(Br)cccc3[nH]2)n1.
What is the InChIKey of acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine?
The InChIKey is OQIWZXOGGLHLDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BrN4.C2H2/c1-3-17-14-8-18-9(2)15(20-14)13-7-10-11(16)5-4-6-12(10)19-13;1-2/h4-8,19H,3H2,1-2H3,(H,17,20);1-2H.
What are the key properties of acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine?
acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine has a molecular weight of 357.26 g/mol, XLogP of 4.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;6-(4-bromo-1H-indol-2-yl)-N-ethyl-5-methylpyrazin-2-amine is sourced from PubChem (CID 144921282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).