About [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite
[1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite (PubChem CID 144921355) has the molecular formula C13H22INOS
and a molecular weight of 367.30 g/mol. Its IUPAC name is [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite.
Molecular Properties
| Compound Name | [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite |
| PubChem CID | 144921355 |
| Molecular Formula | C13H22INOS |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite |
| SMILES | C/C=C\C(=C/C)CN1CC(COSI)CC1C |
| InChI | InChI=1S/C13H22INOS/c1-4-6-12(5-2)8-15-9-13(7-11(15)3)10-16-17-14/h4-6,11,13H,7-10H2,1-3H3/b6-4-,12-5+ |
| InChIKey | LLKOWGNJDNRQOI-GLNLJRCCSA-N |
| XLogP | 4.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite?
The IUPAC name of [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite (CID 144921355) is [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite.
What is the SMILES notation for [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite?
The canonical SMILES for [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite is C/C=C\C(=C/C)CN1CC(COSI)CC1C.
What is the InChIKey of [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite?
The InChIKey is LLKOWGNJDNRQOI-GLNLJRCCSA-N. The full InChI is InChI=1S/C13H22INOS/c1-4-6-12(5-2)8-15-9-13(7-11(15)3)10-16-17-14/h4-6,11,13H,7-10H2,1-3H3/b6-4-,12-5+.
What are the key properties of [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite?
[1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite has a molecular weight of 367.30 g/mol, XLogP of 4.23, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(Z,2E)-2-ethylidenepent-3-enyl]-5-methylpyrrolidin-3-yl]methoxy thiohypoiodite is sourced from PubChem (CID 144921355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).