C19H26N2S2 — CID 144921833
3,6-dimethyl-N-(3-methylsulfanylpropyl)-8,11-dihydro-7H-benzo[c][1,2]benzothiazepin-11-amine (PubChem CID 144921833) has the molecular formula C19H26N2S2 and a molecular weight of 346.57 g/mol. Its IUPAC name is 3,6-dimethyl-N-(3-methylsulfanylpropyl)-8,11-dihydro-7H-benzo[c][1,2]benzothiazepin-11-amine.
| Compound Name | 3,6-dimethyl-N-(3-methylsulfanylpropyl)-8,11-dihydro-7H-benzo[c][1,2]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 144921833 |
| Molecular Formula | C19H26N2S2 |
| Molecular Weight | 346.57 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3,6-dimethyl-N-(3-methylsulfanylpropyl)-8,11-dihydro-7H-benzo[c][1,2]benzothiazepin-11-amine |
| SMILES | CSCCCNC1C2=C(CCC=C2)N(C)Sc2cc(C)ccc21 |
| InChI | InChI=1S/C19H26N2S2/c1-14-9-10-16-18(13-14)23-21(2)17-8-5-4-7-15(17)19(16)20-11-6-12-22-3/h4,7,9-10,13,19-20H,5-6,8,11-12H2,1-3H3 |
| InChIKey | CIKXAPRQANOBLH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|