About 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide
7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide (PubChem CID 144921881) has the molecular formula C28H23FN2O2S
and a molecular weight of 470.57 g/mol. Its IUPAC name is 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide.
Molecular Properties
| Compound Name | 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide |
| PubChem CID | 144921881 |
| Molecular Formula | C28H23FN2O2S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide |
| SMILES | NC=O.O=C1Nc2cc(CCc3ccc(-c4ccccc4)cc3)ccc2Sc2cccc(F)c21 |
| InChI | InChI=1S/C27H20FNOS.CH3NO/c28-22-7-4-8-25-26(22)27(30)29-23-17-19(13-16-24(23)31-25)10-9-18-11-14-21(15-12-18)20-5-2-1-3-6-20;2-1-3/h1-8,11-17H,9-10H2,(H,29,30);1H,(H2,2,3) |
| InChIKey | NCPMAPRKMJWLBU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide?
The IUPAC name of 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide (CID 144921881) is 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide.
What is the SMILES notation for 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide?
The canonical SMILES for 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide is NC=O.O=C1Nc2cc(CCc3ccc(-c4ccccc4)cc3)ccc2Sc2cccc(F)c21.
What is the InChIKey of 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide?
The InChIKey is NCPMAPRKMJWLBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20FNOS.CH3NO/c28-22-7-4-8-25-26(22)27(30)29-23-17-19(13-16-24(23)31-25)10-9-18-11-14-21(15-12-18)20-5-2-1-3-6-20;2-1-3/h1-8,11-17H,9-10H2,(H,29,30);1H,(H2,2,3).
What are the key properties of 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide?
7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide has a molecular weight of 470.57 g/mol, XLogP of 6.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3-[2-(4-phenylphenyl)ethyl]-5H-benzo[b][1,4]benzothiazepin-6-one;formamide is sourced from PubChem (CID 144921881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).