C18H16FN3O2S2 — CID 144921913
9-fluoro-6-hydroxy-N-(1,3-thiazol-5-ylmethyl)-1,2,5,6-tetrahydrobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 144921913) has the molecular formula C18H16FN3O2S2 and a molecular weight of 389.48 g/mol. Its IUPAC name is 9-fluoro-6-hydroxy-N-(1,3-thiazol-5-ylmethyl)-1,2,5,6-tetrahydrobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 9-fluoro-6-hydroxy-N-(1,3-thiazol-5-ylmethyl)-1,2,5,6-tetrahydrobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 144921913 |
| Molecular Formula | C18H16FN3O2S2 |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 9-fluoro-6-hydroxy-N-(1,3-thiazol-5-ylmethyl)-1,2,5,6-tetrahydrobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(NCc1cncs1)C1=CC2=C(CC1)Sc1cc(F)ccc1C(O)N2 |
| InChI | InChI=1S/C18H16FN3O2S2/c19-11-2-3-13-16(6-11)26-15-4-1-10(5-14(15)22-18(13)24)17(23)21-8-12-7-20-9-25-12/h2-3,5-7,9,18,22,24H,1,4,8H2,(H,21,23) |
| InChIKey | VCLCSIYXEFRJBQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |