About 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene
1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene (PubChem CID 14492213) has the molecular formula C7BrF7
and a molecular weight of 296.97 g/mol. Its IUPAC name is 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene |
| PubChem CID | 14492213 |
| Molecular Formula | C7BrF7 |
| Molecular Weight | 296.97 g/mol |
| Exact Mass | 295.91 |
| IUPAC Name | 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene |
| SMILES | Fc1c(F)c(Br)c(F)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C7BrF7/c8-2-3(9)1(7(13,14)15)4(10)6(12)5(2)11 |
| InChIKey | NHSSJMAUKULEMJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.97 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene?
The IUPAC name of 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene (CID 14492213) is 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene.
What is the SMILES notation for 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene?
The canonical SMILES for 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene is Fc1c(F)c(Br)c(F)c(C(F)(F)F)c1F.
What is the InChIKey of 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene?
The InChIKey is NHSSJMAUKULEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7BrF7/c8-2-3(9)1(7(13,14)15)4(10)6(12)5(2)11.
What are the key properties of 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene?
1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene has a molecular weight of 296.97 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene is sourced from PubChem (CID 14492213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).