About 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane
1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane (PubChem CID 144922511) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane.
Molecular Properties
| Compound Name | 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane |
| PubChem CID | 144922511 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane |
| SMILES | C/N=C(\N)N(C)CCC#N.CC |
| InChI | InChI=1S/C6H12N4.C2H6/c1-9-6(8)10(2)5-3-4-7;1-2/h3,5H2,1-2H3,(H2,8,9);1-2H3 |
| InChIKey | AQZAXJWMEIACKR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 65.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane?
The IUPAC name of 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane (CID 144922511) is 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane.
What is the SMILES notation for 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane?
The canonical SMILES for 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane is C/N=C(\N)N(C)CCC#N.CC.
What is the InChIKey of 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane?
The InChIKey is AQZAXJWMEIACKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4.C2H6/c1-9-6(8)10(2)5-3-4-7;1-2/h3,5H2,1-2H3,(H2,8,9);1-2H3.
What are the key properties of 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane?
1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane has a molecular weight of 170.26 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyanoethyl)-1,2-dimethylguanidine;ethane is sourced from PubChem (CID 144922511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).