C10H13N3O3 — CID 144923479
5-[(2S,7S)-7-methyl-2,3,4,7-tetrahydrooxepin-2-yl]-4-nitro-1H-pyrazole (PubChem CID 144923479) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 5-[(2S,7S)-7-methyl-2,3,4,7-tetrahydrooxepin-2-yl]-4-nitro-1H-pyrazole.
| Compound Name | 5-[(2S,7S)-7-methyl-2,3,4,7-tetrahydrooxepin-2-yl]-4-nitro-1H-pyrazole |
|---|---|
| PubChem CID | 144923479 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 5-[(2S,7S)-7-methyl-2,3,4,7-tetrahydrooxepin-2-yl]-4-nitro-1H-pyrazole |
| SMILES | C[C@H]1C=CCC[C@@H](c2[nH]ncc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C10H13N3O3/c1-7-4-2-3-5-9(16-7)10-8(13(14)15)6-11-12-10/h2,4,6-7,9H,3,5H2,1H3,(H,11,12)/t7-,9-/m0/s1 |
| InChIKey | RKDJZSCAJJZYCA-CBAPKCEASA-N |
| XLogP | 2.11 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|