C31H21NO — CID 144924949
(2E)-3-[3-(12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)phenyl]penta-2,4-dien-1-imine (PubChem CID 144924949) has the molecular formula C31H21NO and a molecular weight of 423.52 g/mol. Its IUPAC name is (2E)-3-[3-(12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)phenyl]penta-2,4-dien-1-imine.
| Compound Name | (2E)-3-[3-(12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)phenyl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 144924949 |
| Molecular Formula | C31H21NO |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (2E)-3-[3-(12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)phenyl]penta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C(\C=C)c1cccc(-c2cc3oc4ccc5ccccc5c4c3c3ccccc23)c1 |
| InChI | InChI=1S/C31H21NO/c1-2-20(16-17-32)22-9-7-10-23(18-22)27-19-29-31(26-13-6-5-12-25(26)27)30-24-11-4-3-8-21(24)14-15-28(30)33-29/h2-19,32H,1H2/b20-16+,32-17+ |
| InChIKey | PFMIIEVOCJMQED-GKEGOZSRSA-N |
| XLogP | 8.78 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|