About (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile
(2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile (PubChem CID 144925030) has the molecular formula C25H22N2O
and a molecular weight of 366.46 g/mol. Its IUPAC name is (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile |
| PubChem CID | 144925030 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile |
| SMILES | COc1cc(-c2ccccc2)ccc1-c1ccc(C(/C=C(\C)C#N)=C/N)cc1 |
| InChI | InChI=1S/C25H22N2O/c1-18(16-26)14-23(17-27)20-8-10-21(11-9-20)24-13-12-22(15-25(24)28-2)19-6-4-3-5-7-19/h3-15,17H,27H2,1-2H3/b18-14+,23-17+ |
| InChIKey | HJRAKUZRJJLJGK-CIAKQHAXSA-N |
| XLogP | 5.80 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile?
The IUPAC name of (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile (CID 144925030) is (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile.
What is the SMILES notation for (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile?
The canonical SMILES for (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile is COc1cc(-c2ccccc2)ccc1-c1ccc(C(/C=C(\C)C#N)=C/N)cc1.
What is the InChIKey of (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile?
The InChIKey is HJRAKUZRJJLJGK-CIAKQHAXSA-N. The full InChI is InChI=1S/C25H22N2O/c1-18(16-26)14-23(17-27)20-8-10-21(11-9-20)24-13-12-22(15-25(24)28-2)19-6-4-3-5-7-19/h3-15,17H,27H2,1-2H3/b18-14+,23-17+.
What are the key properties of (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile?
(2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile has a molecular weight of 366.46 g/mol, XLogP of 5.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-5-amino-4-[4-(2-methoxy-4-phenylphenyl)phenyl]-2-methylpenta-2,4-dienenitrile is sourced from PubChem (CID 144925030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).