About N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide
N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide (PubChem CID 144925775) has the molecular formula C12H20N2OS
and a molecular weight of 240.37 g/mol. Its IUPAC name is N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide.
Molecular Properties
| Compound Name | N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide |
| PubChem CID | 144925775 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide |
| SMILES | CCNSc1ccc(CC)cc1.CNC=O |
| InChI | InChI=1S/C10H15NS.C2H5NO/c1-3-9-5-7-10(8-6-9)12-11-4-2;1-3-2-4/h5-8,11H,3-4H2,1-2H3;2H,1H3,(H,3,4) |
| InChIKey | XUQOLEWRDHIUSN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide?
The IUPAC name of N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide (CID 144925775) is N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide.
What is the SMILES notation for N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide?
The canonical SMILES for N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide is CCNSc1ccc(CC)cc1.CNC=O.
What is the InChIKey of N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide?
The InChIKey is XUQOLEWRDHIUSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NS.C2H5NO/c1-3-9-5-7-10(8-6-9)12-11-4-2;1-3-2-4/h5-8,11H,3-4H2,1-2H3;2H,1H3,(H,3,4).
What are the key properties of N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide?
N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide has a molecular weight of 240.37 g/mol, XLogP of 2.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethylphenyl)sulfanylethanamine;N-methylformamide is sourced from PubChem (CID 144925775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).