C45H31N3S — CID 144925982
3-dibenzothiophen-4-yl-N-[(Z)-3-imino-3-[4-(4-phenylphenyl)phenyl]prop-1-enyl]carbazol-9-amine (PubChem CID 144925982) has the molecular formula C45H31N3S and a molecular weight of 645.83 g/mol. Its IUPAC name is 3-dibenzothiophen-4-yl-N-[(Z)-3-imino-3-[4-(4-phenylphenyl)phenyl]prop-1-enyl]carbazol-9-amine.
| Compound Name | 3-dibenzothiophen-4-yl-N-[(Z)-3-imino-3-[4-(4-phenylphenyl)phenyl]prop-1-enyl]carbazol-9-amine |
|---|---|
| PubChem CID | 144925982 |
| Molecular Formula | C45H31N3S |
| Molecular Weight | 645.83 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | 3-dibenzothiophen-4-yl-N-[(Z)-3-imino-3-[4-(4-phenylphenyl)phenyl]prop-1-enyl]carbazol-9-amine |
| SMILES | [H]/N=C(/C=C\Nn1c2ccccc2c2cc(-c3cccc4c3sc3ccccc34)ccc21)c1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C45H31N3S/c46-41(34-23-21-33(22-24-34)32-19-17-31(18-20-32)30-9-2-1-3-10-30)27-28-47-48-42-15-6-4-11-37(42)40-29-35(25-26-43(40)48)36-13-8-14-39-38-12-5-7-16-44(38)49-45(36)39/h1-29,46-47H/b28-27-,46-41- |
| InChIKey | MDBZGSNRWWVFLR-HQUPQUGYSA-N |
| XLogP | 12.29 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.83 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|