About 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine
4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine (PubChem CID 144926144) has the molecular formula C17H38F2N2O
and a molecular weight of 324.50 g/mol. Its IUPAC name is 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine.
Molecular Properties
| Compound Name | 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine |
| PubChem CID | 144926144 |
| Molecular Formula | C17H38F2N2O |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine |
| SMILES | CC.CC.CCC1CN(C)CCO1.CN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H15NO.C6H11F2N.2C2H6/c1-3-7-6-8(2)4-5-9-7;1-9-4-2-6(7,8)3-5-9;2*1-2/h7H,3-6H2,1-2H3;2-5H2,1H3;2*1-2H3 |
| InChIKey | YAUBTVNMZWQSIG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine?
The IUPAC name of 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine (CID 144926144) is 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine.
What is the SMILES notation for 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine?
The canonical SMILES for 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine is CC.CC.CCC1CN(C)CCO1.CN1CCC(F)(F)CC1.
What is the InChIKey of 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine?
The InChIKey is YAUBTVNMZWQSIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C6H11F2N.2C2H6/c1-3-7-6-8(2)4-5-9-7;1-9-4-2-6(7,8)3-5-9;2*1-2/h7H,3-6H2,1-2H3;2-5H2,1H3;2*1-2H3.
What are the key properties of 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine?
4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine has a molecular weight of 324.50 g/mol, XLogP of 4.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-1-methylpiperidine;ethane;2-ethyl-4-methylmorpholine is sourced from PubChem (CID 144926144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).