C24H34O2 — CID 144926359
2-[[(3E,5E)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,7-dimethylocta-3,5-dien-4-yl]oxymethyl]cyclohexa-1,3-diene (PubChem CID 144926359) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is 2-[[(3E,5E)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,7-dimethylocta-3,5-dien-4-yl]oxymethyl]cyclohexa-1,3-diene.
| Compound Name | 2-[[(3E,5E)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,7-dimethylocta-3,5-dien-4-yl]oxymethyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144926359 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 2-[[(3E,5E)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,7-dimethylocta-3,5-dien-4-yl]oxymethyl]cyclohexa-1,3-diene |
| SMILES | C=C/C=C(\C=C)COC(=C/C(C)C)/C(=C\C(C)C)OCC1=CCCC=C1 |
| InChI | InChI=1S/C24H34O2/c1-7-12-21(8-2)17-25-23(15-19(3)4)24(16-20(5)6)26-18-22-13-10-9-11-14-22/h7-8,10,12-16,19-20H,1-2,9,11,17-18H2,3-6H3/b21-12+,23-15+,24-16+ |
| InChIKey | UUNZXVLICPDWIR-KXHYNRPXSA-N |
| XLogP | 6.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|